C24H24ClN3O2 — CID 169128491
7-chloro-3-[[[(2E)-2-[(methylideneamino)methylidene]but-3-enyl]amino]methyl]-1-(2-phenoxyethyl)quinolin-2-one (PubChem CID 169128491) has the molecular formula C24H24ClN3O2 and a molecular weight of 421.93 g/mol. Its IUPAC name is 7-chloro-3-[[[(2E)-2-[(methylideneamino)methylidene]but-3-enyl]amino]methyl]-1-(2-phenoxyethyl)quinolin-2-one.
| Compound Name | 7-chloro-3-[[[(2E)-2-[(methylideneamino)methylidene]but-3-enyl]amino]methyl]-1-(2-phenoxyethyl)quinolin-2-one |
|---|---|
| PubChem CID | 169128491 |
| Molecular Formula | C24H24ClN3O2 |
| Molecular Weight | 421.93 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 7-chloro-3-[[[(2E)-2-[(methylideneamino)methylidene]but-3-enyl]amino]methyl]-1-(2-phenoxyethyl)quinolin-2-one |
| SMILES | C=C/C(=C\N=C)CNCc1cc2ccc(Cl)cc2n(CCOc2ccccc2)c1=O |
| InChI | InChI=1S/C24H24ClN3O2/c1-3-18(15-26-2)16-27-17-20-13-19-9-10-21(25)14-23(19)28(24(20)29)11-12-30-22-7-5-4-6-8-22/h3-10,13-15,27H,1-2,11-12,16-17H2/b18-15+ |
| InChIKey | DFKOZOSFKSPIGH-OBGWFSINSA-N |
| XLogP | 4.59 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.93 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|