C26H26BrClN2O2 — CID 169128512
3-[[[(3Z,5E)-6-bromo-2-methylidenehepta-3,5-dienyl]amino]methyl]-7-chloro-1-(2-phenoxyethyl)quinolin-2-one (PubChem CID 169128512) has the molecular formula C26H26BrClN2O2 and a molecular weight of 513.86 g/mol. Its IUPAC name is 3-[[[(3Z,5E)-6-bromo-2-methylidenehepta-3,5-dienyl]amino]methyl]-7-chloro-1-(2-phenoxyethyl)quinolin-2-one.
| Compound Name | 3-[[[(3Z,5E)-6-bromo-2-methylidenehepta-3,5-dienyl]amino]methyl]-7-chloro-1-(2-phenoxyethyl)quinolin-2-one |
|---|---|
| PubChem CID | 169128512 |
| Molecular Formula | C26H26BrClN2O2 |
| Molecular Weight | 513.86 g/mol |
| Exact Mass | 512.09 |
| IUPAC Name | 3-[[[(3Z,5E)-6-bromo-2-methylidenehepta-3,5-dienyl]amino]methyl]-7-chloro-1-(2-phenoxyethyl)quinolin-2-one |
| SMILES | C=C(/C=C\C=C(/C)Br)CNCc1cc2ccc(Cl)cc2n(CCOc2ccccc2)c1=O |
| InChI | InChI=1S/C26H26BrClN2O2/c1-19(7-6-8-20(2)27)17-29-18-22-15-21-11-12-23(28)16-25(21)30(26(22)31)13-14-32-24-9-4-3-5-10-24/h3-12,15-16,29H,1,13-14,17-18H2,2H3/b7-6-,20-8+ |
| InChIKey | FRSCLEPRFDJGEC-AIJOWKIWSA-N |
| XLogP | 6.23 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.86 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|