C24H29N3O4 — CID 143687890
(2S)-2-[[1-(2-ethoxyethyl)-7-(4-methoxyphenyl)-2-oxoquinolin-3-yl]methylamino]propanamide (PubChem CID 143687890) has the molecular formula C24H29N3O4 and a molecular weight of 423.51 g/mol. Its IUPAC name is (2S)-2-[[1-(2-ethoxyethyl)-7-(4-methoxyphenyl)-2-oxoquinolin-3-yl]methylamino]propanamide.
| Compound Name | (2S)-2-[[1-(2-ethoxyethyl)-7-(4-methoxyphenyl)-2-oxoquinolin-3-yl]methylamino]propanamide |
|---|---|
| PubChem CID | 143687890 |
| Molecular Formula | C24H29N3O4 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | (2S)-2-[[1-(2-ethoxyethyl)-7-(4-methoxyphenyl)-2-oxoquinolin-3-yl]methylamino]propanamide |
| SMILES | CCOCCn1c(=O)c(CN[C@@H](C)C(N)=O)cc2ccc(-c3ccc(OC)cc3)cc21 |
| InChI | InChI=1S/C24H29N3O4/c1-4-31-12-11-27-22-14-18(17-7-9-21(30-3)10-8-17)5-6-19(22)13-20(24(27)29)15-26-16(2)23(25)28/h5-10,13-14,16,26H,4,11-12,15H2,1-3H3,(H2,25,28)/t16-/m0/s1 |
| InChIKey | ZCYBUMYCAQGUPD-INIZCTEOSA-N |
| XLogP | 2.68 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|