C26H33N3O4 — CID 126490375
(4R,5S,8S,10R)-3-(cyclohexylmethyl)-5-hydroxy-13-methoxyspiro[3-azapentacyclo[8.6.1.01,4.05,10.011,16]heptadeca-11(16),12,14-triene-8,5'-imidazolidine]-2',4'-dione (PubChem CID 126490375) has the molecular formula C26H33N3O4 and a molecular weight of 451.57 g/mol. Its IUPAC name is (4R,5S,8S,10R)-3-(cyclohexylmethyl)-5-hydroxy-13-methoxyspiro[3-azapentacyclo[8.6.1.01,4.05,10.011,16]heptadeca-11(16),12,14-triene-8,5'-imidazolidine]-2',4'-dione.
| Compound Name | (4R,5S,8S,10R)-3-(cyclohexylmethyl)-5-hydroxy-13-methoxyspiro[3-azapentacyclo[8.6.1.01,4.05,10.011,16]heptadeca-11(16),12,14-triene-8,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 126490375 |
| Molecular Formula | C26H33N3O4 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | (4R,5S,8S,10R)-3-(cyclohexylmethyl)-5-hydroxy-13-methoxyspiro[3-azapentacyclo[8.6.1.01,4.05,10.011,16]heptadeca-11(16),12,14-triene-8,5'-imidazolidine]-2',4'-dione |
| SMILES | COc1ccc2c(c1)[C@]13CC24CN(CC2CCCCC2)[C@H]4[C@]1(O)CC[C@@]1(C3)NC(=O)NC1=O |
| InChI | InChI=1S/C26H33N3O4/c1-33-17-7-8-18-19(11-17)24-13-23(18)15-29(12-16-5-3-2-4-6-16)20(23)26(24,32)10-9-25(14-24)21(30)27-22(31)28-25/h7-8,11,16,20,32H,2-6,9-10,12-15H2,1H3,(H2,27,28,30,31)/t20-,23?,24-,25+,26-/m1/s1 |
| InChIKey | ARAGPWTZTBPRDL-UXZIWUSFSA-N |
| XLogP | 2.35 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|