C23H30N4O4 — CID 144970141
(8S)-3-[3-(dimethylamino)propyl]-5,13-dihydroxyspiro[3-azapentacyclo[8.6.1.01,4.05,10.011,16]heptadeca-11(16),12,14-triene-8,5'-imidazolidine]-2',4'-dione (PubChem CID 144970141) has the molecular formula C23H30N4O4 and a molecular weight of 426.52 g/mol. Its IUPAC name is (8S)-3-[3-(dimethylamino)propyl]-5,13-dihydroxyspiro[3-azapentacyclo[8.6.1.01,4.05,10.011,16]heptadeca-11(16),12,14-triene-8,5'-imidazolidine]-2',4'-dione.
| Compound Name | (8S)-3-[3-(dimethylamino)propyl]-5,13-dihydroxyspiro[3-azapentacyclo[8.6.1.01,4.05,10.011,16]heptadeca-11(16),12,14-triene-8,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 144970141 |
| Molecular Formula | C23H30N4O4 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | (8S)-3-[3-(dimethylamino)propyl]-5,13-dihydroxyspiro[3-azapentacyclo[8.6.1.01,4.05,10.011,16]heptadeca-11(16),12,14-triene-8,5'-imidazolidine]-2',4'-dione |
| SMILES | CN(C)CCCN1CC23CC4(C[C@]5(CCC4(O)C12)NC(=O)NC5=O)c1cc(O)ccc13 |
| InChI | InChI=1S/C23H30N4O4/c1-26(2)8-3-9-27-13-20-11-21(16-10-14(28)4-5-15(16)20)12-22(18(29)24-19(30)25-22)6-7-23(21,31)17(20)27/h4-5,10,17,28,31H,3,6-9,11-13H2,1-2H3,(H2,24,25,29,30)/t17?,20?,21?,22-,23?/m0/s1 |
| InChIKey | PPYUJJWSJSGNKW-BHFYJTKLSA-N |
| XLogP | 0.41 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|