C25H22N2O4 — CID 126491328
2-[(7R,12bS)-9-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]isoindole-1,3-dione (PubChem CID 126491328) has the molecular formula C25H22N2O4 and a molecular weight of 414.46 g/mol. Its IUPAC name is 2-[(7R,12bS)-9-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]isoindole-1,3-dione.
| Compound Name | 2-[(7R,12bS)-9-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 126491328 |
| Molecular Formula | C25H22N2O4 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 2-[(7R,12bS)-9-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]isoindole-1,3-dione |
| SMILES | CN1CC[C@]23c4c5ccc(O)c4OC2[C@H](N2C(=O)c4ccccc4C2=O)C=CC3C1C5 |
| InChI | InChI=1S/C25H22N2O4/c1-26-11-10-25-16-7-8-17(27-23(29)14-4-2-3-5-15(14)24(27)30)22(25)31-21-19(28)9-6-13(20(21)25)12-18(16)26/h2-9,16-18,22,28H,10-12H2,1H3/t16?,17-,18?,22?,25+/m1/s1 |
| InChIKey | PHTJQBCZRBVFIK-VWBXKBIWSA-N |
| XLogP | 2.50 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|