C25H28N2O4 — CID 126491581
2-(9-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 126491581) has the molecular formula C25H28N2O4 and a molecular weight of 420.51 g/mol. Its IUPAC name is 2-(9-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | 2-(9-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 126491581 |
| Molecular Formula | C25H28N2O4 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 2-(9-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | CN1CCC23c4c5ccc(O)c4OC2C(N2C(=O)C4CCCCC4C2=O)C=CC3C1C5 |
| InChI | InChI=1S/C25H28N2O4/c1-26-11-10-25-16-7-8-17(27-23(29)14-4-2-3-5-15(14)24(27)30)22(25)31-21-19(28)9-6-13(20(21)25)12-18(16)26/h6-9,14-18,22,28H,2-5,10-12H2,1H3 |
| InChIKey | BDFLZXZWLCTSGF-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|