C16H9N3 — CID 126492572
6-(2-methylphenyl)benzene-1,2,4-tricarbonitrile (PubChem CID 126492572) has the molecular formula C16H9N3 and a molecular weight of 243.27 g/mol. Its IUPAC name is 6-(2-methylphenyl)benzene-1,2,4-tricarbonitrile.
| Compound Name | 6-(2-methylphenyl)benzene-1,2,4-tricarbonitrile |
|---|---|
| PubChem CID | 126492572 |
| Molecular Formula | C16H9N3 |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | 6-(2-methylphenyl)benzene-1,2,4-tricarbonitrile |
| SMILES | Cc1ccccc1-c1cc(C#N)cc(C#N)c1C#N |
| InChI | InChI=1S/C16H9N3/c1-11-4-2-3-5-14(11)15-7-12(8-17)6-13(9-18)16(15)10-19/h2-7H,1H3 |
| InChIKey | IOSHPZCREQDKOX-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 71.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |