C22H18N3+ — CID 170397945
5-methyl-4-[1-methyl-6-(2-methylphenyl)pyridin-1-ium-2-yl]benzene-1,3-dicarbonitrile (PubChem CID 170397945) has the molecular formula C22H18N3+ and a molecular weight of 324.41 g/mol. Its IUPAC name is 5-methyl-4-[1-methyl-6-(2-methylphenyl)pyridin-1-ium-2-yl]benzene-1,3-dicarbonitrile.
| Compound Name | 5-methyl-4-[1-methyl-6-(2-methylphenyl)pyridin-1-ium-2-yl]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 170397945 |
| Molecular Formula | C22H18N3+ |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 5-methyl-4-[1-methyl-6-(2-methylphenyl)pyridin-1-ium-2-yl]benzene-1,3-dicarbonitrile |
| SMILES | Cc1ccccc1-c1cccc(-c2c(C)cc(C#N)cc2C#N)[n+]1C |
| InChI | InChI=1S/C22H18N3/c1-15-7-4-5-8-19(15)20-9-6-10-21(25(20)3)22-16(2)11-17(13-23)12-18(22)14-24/h4-12H,1-3H3/q+1 |
| InChIKey | BAJTTWJVCVWHOQ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 51.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|