About (2-hydroxyphenyl) N-cyclohexylsulfamate
(2-hydroxyphenyl) N-cyclohexylsulfamate (PubChem CID 12649337) has the molecular formula C12H17NO4S
and a molecular weight of 271.34 g/mol. Its IUPAC name is (2-hydroxyphenyl) N-cyclohexylsulfamate.
Molecular Properties
| Compound Name | (2-hydroxyphenyl) N-cyclohexylsulfamate |
| PubChem CID | 12649337 |
| Molecular Formula | C12H17NO4S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | (2-hydroxyphenyl) N-cyclohexylsulfamate |
| SMILES | O=S(=O)(NC1CCCCC1)Oc1ccccc1O |
| InChI | InChI=1S/C12H17NO4S/c14-11-8-4-5-9-12(11)17-18(15,16)13-10-6-2-1-3-7-10/h4-5,8-10,13-14H,1-3,6-7H2 |
| InChIKey | MHXAXXAZQKKVNE-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-hydroxyphenyl) N-cyclohexylsulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-hydroxyphenyl) N-cyclohexylsulfamate?
The IUPAC name of (2-hydroxyphenyl) N-cyclohexylsulfamate (CID 12649337) is (2-hydroxyphenyl) N-cyclohexylsulfamate.
What is the SMILES notation for (2-hydroxyphenyl) N-cyclohexylsulfamate?
The canonical SMILES for (2-hydroxyphenyl) N-cyclohexylsulfamate is O=S(=O)(NC1CCCCC1)Oc1ccccc1O.
What is the InChIKey of (2-hydroxyphenyl) N-cyclohexylsulfamate?
The InChIKey is MHXAXXAZQKKVNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO4S/c14-11-8-4-5-9-12(11)17-18(15,16)13-10-6-2-1-3-7-10/h4-5,8-10,13-14H,1-3,6-7H2.
What are the key properties of (2-hydroxyphenyl) N-cyclohexylsulfamate?
(2-hydroxyphenyl) N-cyclohexylsulfamate has a molecular weight of 271.34 g/mol, XLogP of 1.94, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hydroxyphenyl) N-cyclohexylsulfamate is sourced from PubChem (CID 12649337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).