About N-cyclohexylsulfamate;triphenylsulfanium
N-cyclohexylsulfamate;triphenylsulfanium (PubChem CID 87267054) has the molecular formula C24H27NO3S2
and a molecular weight of 441.62 g/mol. Its IUPAC name is N-cyclohexylsulfamate;triphenylsulfanium.
Molecular Properties
| Compound Name | N-cyclohexylsulfamate;triphenylsulfanium |
| PubChem CID | 87267054 |
| Molecular Formula | C24H27NO3S2 |
| Molecular Weight | 441.62 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | N-cyclohexylsulfamate;triphenylsulfanium |
| SMILES | O=S(=O)([O-])NC1CCCCC1.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C6H13NO3S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;8-11(9,10)7-6-4-2-1-3-5-6/h1-15H;6-7H,1-5H2,(H,8,9,10)/q+1;/p-1 |
| InChIKey | PTQIBOHIVVPPCJ-UHFFFAOYSA-M |
| XLogP | 5.15 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 441.62 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze N-cyclohexylsulfamate;triphenylsulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexylsulfamate;triphenylsulfanium?
The IUPAC name of N-cyclohexylsulfamate;triphenylsulfanium (CID 87267054) is N-cyclohexylsulfamate;triphenylsulfanium.
What is the SMILES notation for N-cyclohexylsulfamate;triphenylsulfanium?
The canonical SMILES for N-cyclohexylsulfamate;triphenylsulfanium is O=S(=O)([O-])NC1CCCCC1.c1ccc([S+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of N-cyclohexylsulfamate;triphenylsulfanium?
The InChIKey is PTQIBOHIVVPPCJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H15S.C6H13NO3S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;8-11(9,10)7-6-4-2-1-3-5-6/h1-15H;6-7H,1-5H2,(H,8,9,10)/q+1;/p-1.
What are the key properties of N-cyclohexylsulfamate;triphenylsulfanium?
N-cyclohexylsulfamate;triphenylsulfanium has a molecular weight of 441.62 g/mol, XLogP of 5.15, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexylsulfamate;triphenylsulfanium is sourced from PubChem (CID 87267054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).