C6H12N2Na2O6S2 — CID 101095767
disodium;N-[4-(sulfonatoamino)cyclohexyl]sulfamate (PubChem CID 101095767) has the molecular formula C6H12N2Na2O6S2 and a molecular weight of 318.28 g/mol. Its IUPAC name is disodium;N-[4-(sulfonatoamino)cyclohexyl]sulfamate.
| Compound Name | disodium;N-[4-(sulfonatoamino)cyclohexyl]sulfamate |
|---|---|
| PubChem CID | 101095767 |
| Molecular Formula | C6H12N2Na2O6S2 |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 317.99 |
| IUPAC Name | disodium;N-[4-(sulfonatoamino)cyclohexyl]sulfamate |
| SMILES | O=S(=O)([O-])NC1CCC(NS(=O)(=O)[O-])CC1.[Na+].[Na+] |
| InChI | InChI=1S/C6H14N2O6S2.2Na/c9-15(10,11)7-5-1-2-6(4-3-5)8-16(12,13)14;;/h5-8H,1-4H2,(H,9,10,11)(H,12,13,14);;/q;2*+1/p-2 |
| InChIKey | WGEOXVURECHCCU-UHFFFAOYSA-L |
| XLogP | -7.59 |
| TPSA | 138.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | -7.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|