C7H16N3NaO7S2 — CID 158035889
sodium;cyclopropylsulfamic acid;N-morpholin-4-ylsulfamate (PubChem CID 158035889) has the molecular formula C7H16N3NaO7S2 and a molecular weight of 341.34 g/mol. Its IUPAC name is sodium;cyclopropylsulfamic acid;N-morpholin-4-ylsulfamate.
| Compound Name | sodium;cyclopropylsulfamic acid;N-morpholin-4-ylsulfamate |
|---|---|
| PubChem CID | 158035889 |
| Molecular Formula | C7H16N3NaO7S2 |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | sodium;cyclopropylsulfamic acid;N-morpholin-4-ylsulfamate |
| SMILES | O=S(=O)(O)NC1CC1.O=S(=O)([O-])NN1CCOCC1.[Na+] |
| InChI | InChI=1S/C4H10N2O4S.C3H7NO3S.Na/c7-11(8,9)5-6-1-3-10-4-2-6;5-8(6,7)4-3-1-2-3;/h5H,1-4H2,(H,7,8,9);3-4H,1-2H2,(H,5,6,7);/q;;+1/p-1 |
| InChIKey | FHSVLHDUDFUKRK-UHFFFAOYSA-M |
| XLogP | -5.17 |
| TPSA | 148.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | -5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|