C10H22N4O5S — CID 142470323
carboxymethyl-(diaminomethylidene)-methylazanium;N-cyclohexylsulfamate (PubChem CID 142470323) has the molecular formula C10H22N4O5S and a molecular weight of 310.38 g/mol. Its IUPAC name is carboxymethyl-(diaminomethylidene)-methylazanium;N-cyclohexylsulfamate.
| Compound Name | carboxymethyl-(diaminomethylidene)-methylazanium;N-cyclohexylsulfamate |
|---|---|
| PubChem CID | 142470323 |
| Molecular Formula | C10H22N4O5S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | carboxymethyl-(diaminomethylidene)-methylazanium;N-cyclohexylsulfamate |
| SMILES | C[N+](CC(=O)O)=C(N)N.O=S(=O)([O-])NC1CCCCC1 |
| InChI | InChI=1S/C6H13NO3S.C4H9N3O2/c8-11(9,10)7-6-4-2-1-3-5-6;1-7(4(5)6)2-3(8)9/h6-7H,1-5H2,(H,8,9,10);2H2,1H3,(H4,5,6,8,9) |
| InChIKey | OLMUZSCJPJTYJW-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 161.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|