C24H25O2S2+ — CID 155764700
(3-cyclohexylsulfonylphenyl)-diphenylsulfanium (PubChem CID 155764700) has the molecular formula C24H25O2S2+ and a molecular weight of 409.60 g/mol. Its IUPAC name is (3-cyclohexylsulfonylphenyl)-diphenylsulfanium.
| Compound Name | (3-cyclohexylsulfonylphenyl)-diphenylsulfanium |
|---|---|
| PubChem CID | 155764700 |
| Molecular Formula | C24H25O2S2+ |
| Molecular Weight | 409.60 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | (3-cyclohexylsulfonylphenyl)-diphenylsulfanium |
| SMILES | O=S(=O)(c1cccc([S+](c2ccccc2)c2ccccc2)c1)C1CCCCC1 |
| InChI | InChI=1S/C24H25O2S2/c25-28(26,23-16-8-3-9-17-23)24-18-10-15-22(19-24)27(20-11-4-1-5-12-20)21-13-6-2-7-14-21/h1-2,4-7,10-15,18-19,23H,3,8-9,16-17H2/q+1 |
| InChIKey | KUCZRQGGITYUBX-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.60 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|