C13H18O3S — CID 69436577
2-(3-cyclopentylsulfonylphenyl)ethanol (PubChem CID 69436577) has the molecular formula C13H18O3S and a molecular weight of 254.35 g/mol. Its IUPAC name is 2-(3-cyclopentylsulfonylphenyl)ethanol.
| Compound Name | 2-(3-cyclopentylsulfonylphenyl)ethanol |
|---|---|
| PubChem CID | 69436577 |
| Molecular Formula | C13H18O3S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | 2-(3-cyclopentylsulfonylphenyl)ethanol |
| SMILES | O=S(=O)(c1cccc(CCO)c1)C1CCCC1 |
| InChI | InChI=1S/C13H18O3S/c14-9-8-11-4-3-7-13(10-11)17(15,16)12-5-1-2-6-12/h3-4,7,10,12,14H,1-2,5-6,8-9H2 |
| InChIKey | KQPAJPZAFMJPLJ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |