C22H27NO4S — CID 86943568
4-cyclopentylsulfonyl-N-(2-hydroxyethyl)-N-(2-phenylethyl)benzamide (PubChem CID 86943568) has the molecular formula C22H27NO4S and a molecular weight of 401.53 g/mol. Its IUPAC name is 4-cyclopentylsulfonyl-N-(2-hydroxyethyl)-N-(2-phenylethyl)benzamide.
| Compound Name | 4-cyclopentylsulfonyl-N-(2-hydroxyethyl)-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 86943568 |
| Molecular Formula | C22H27NO4S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 4-cyclopentylsulfonyl-N-(2-hydroxyethyl)-N-(2-phenylethyl)benzamide |
| SMILES | O=C(c1ccc(S(=O)(=O)C2CCCC2)cc1)N(CCO)CCc1ccccc1 |
| InChI | InChI=1S/C22H27NO4S/c24-17-16-23(15-14-18-6-2-1-3-7-18)22(25)19-10-12-21(13-11-19)28(26,27)20-8-4-5-9-20/h1-3,6-7,10-13,20,24H,4-5,8-9,14-17H2 |
| InChIKey | PNROBUFEQJYODQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |