C24H25NO4S — CID 86943575
3-(benzenesulfonylmethyl)-N-(2-hydroxyethyl)-N-(2-phenylethyl)benzamide (PubChem CID 86943575) has the molecular formula C24H25NO4S and a molecular weight of 423.53 g/mol. Its IUPAC name is 3-(benzenesulfonylmethyl)-N-(2-hydroxyethyl)-N-(2-phenylethyl)benzamide.
| Compound Name | 3-(benzenesulfonylmethyl)-N-(2-hydroxyethyl)-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 86943575 |
| Molecular Formula | C24H25NO4S |
| Molecular Weight | 423.53 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | 3-(benzenesulfonylmethyl)-N-(2-hydroxyethyl)-N-(2-phenylethyl)benzamide |
| SMILES | O=C(c1cccc(CS(=O)(=O)c2ccccc2)c1)N(CCO)CCc1ccccc1 |
| InChI | InChI=1S/C24H25NO4S/c26-17-16-25(15-14-20-8-3-1-4-9-20)24(27)22-11-7-10-21(18-22)19-30(28,29)23-12-5-2-6-13-23/h1-13,18,26H,14-17,19H2 |
| InChIKey | APZGFPUSXAGCIO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.53 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |