C20H23NO4S — CID 91651646
4-cyclopentylsulfonyl-N-[3-(hydroxymethyl)phenyl]-N-methylbenzamide (PubChem CID 91651646) has the molecular formula C20H23NO4S and a molecular weight of 373.47 g/mol. Its IUPAC name is 4-cyclopentylsulfonyl-N-[3-(hydroxymethyl)phenyl]-N-methylbenzamide.
| Compound Name | 4-cyclopentylsulfonyl-N-[3-(hydroxymethyl)phenyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 91651646 |
| Molecular Formula | C20H23NO4S |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 4-cyclopentylsulfonyl-N-[3-(hydroxymethyl)phenyl]-N-methylbenzamide |
| SMILES | CN(C(=O)c1ccc(S(=O)(=O)C2CCCC2)cc1)c1cccc(CO)c1 |
| InChI | InChI=1S/C20H23NO4S/c1-21(17-6-4-5-15(13-17)14-22)20(23)16-9-11-19(12-10-16)26(24,25)18-7-2-3-8-18/h4-6,9-13,18,22H,2-3,7-8,14H2,1H3 |
| InChIKey | RJDNQICBOUDDCK-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |