C20H34N2O3S — CID 87997530
N-cyclohexylsulfamate;ethyl-dimethyl-(1-phenylbut-3-enyl)azanium (PubChem CID 87997530) has the molecular formula C20H34N2O3S and a molecular weight of 382.57 g/mol. Its IUPAC name is N-cyclohexylsulfamate;ethyl-dimethyl-(1-phenylbut-3-enyl)azanium.
| Compound Name | N-cyclohexylsulfamate;ethyl-dimethyl-(1-phenylbut-3-enyl)azanium |
|---|---|
| PubChem CID | 87997530 |
| Molecular Formula | C20H34N2O3S |
| Molecular Weight | 382.57 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | N-cyclohexylsulfamate;ethyl-dimethyl-(1-phenylbut-3-enyl)azanium |
| SMILES | C=CCC(c1ccccc1)[N+](C)(C)CC.O=S(=O)([O-])NC1CCCCC1 |
| InChI | InChI=1S/C14H22N.C6H13NO3S/c1-5-10-14(15(3,4)6-2)13-11-8-7-9-12-13;8-11(9,10)7-6-4-2-1-3-5-6/h5,7-9,11-12,14H,1,6,10H2,2-4H3;6-7H,1-5H2,(H,8,9,10)/q+1;/p-1 |
| InChIKey | SAHCKAUJILCEGG-UHFFFAOYSA-M |
| XLogP | 3.77 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.57 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|