About naphthalen-1-amine;(sulfamoylamino)cyclohexane
naphthalen-1-amine;(sulfamoylamino)cyclohexane (PubChem CID 158467911) has the molecular formula C16H23N3O2S
and a molecular weight of 321.45 g/mol. Its IUPAC name is naphthalen-1-amine;(sulfamoylamino)cyclohexane.
Molecular Properties
| Compound Name | naphthalen-1-amine;(sulfamoylamino)cyclohexane |
| PubChem CID | 158467911 |
| Molecular Formula | C16H23N3O2S |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | naphthalen-1-amine;(sulfamoylamino)cyclohexane |
| SMILES | NS(=O)(=O)NC1CCCCC1.Nc1cccc2ccccc12 |
| InChI | InChI=1S/C10H9N.C6H14N2O2S/c11-10-7-3-5-8-4-1-2-6-9(8)10;7-11(9,10)8-6-4-2-1-3-5-6/h1-7H,11H2;6,8H,1-5H2,(H2,7,9,10) |
| InChIKey | HFZFTKZUQXCPSG-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze naphthalen-1-amine;(sulfamoylamino)cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalen-1-amine;(sulfamoylamino)cyclohexane?
The IUPAC name of naphthalen-1-amine;(sulfamoylamino)cyclohexane (CID 158467911) is naphthalen-1-amine;(sulfamoylamino)cyclohexane.
What is the SMILES notation for naphthalen-1-amine;(sulfamoylamino)cyclohexane?
The canonical SMILES for naphthalen-1-amine;(sulfamoylamino)cyclohexane is NS(=O)(=O)NC1CCCCC1.Nc1cccc2ccccc12.
What is the InChIKey of naphthalen-1-amine;(sulfamoylamino)cyclohexane?
The InChIKey is HFZFTKZUQXCPSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N.C6H14N2O2S/c11-10-7-3-5-8-4-1-2-6-9(8)10;7-11(9,10)8-6-4-2-1-3-5-6/h1-7H,11H2;6,8H,1-5H2,(H2,7,9,10).
What are the key properties of naphthalen-1-amine;(sulfamoylamino)cyclohexane?
naphthalen-1-amine;(sulfamoylamino)cyclohexane has a molecular weight of 321.45 g/mol, XLogP of 2.53, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalen-1-amine;(sulfamoylamino)cyclohexane is sourced from PubChem (CID 158467911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).