C30H31F2NO3 — CID 126494945
(Z)-5-(3-fluoro-4-methoxyphenyl)-1-[4-[4-(fluoromethyl)phenyl]-4-hydroxypiperidin-1-yl]-3-phenylpent-2-en-1-one (PubChem CID 126494945) has the molecular formula C30H31F2NO3 and a molecular weight of 491.58 g/mol. Its IUPAC name is (Z)-5-(3-fluoro-4-methoxyphenyl)-1-[4-[4-(fluoromethyl)phenyl]-4-hydroxypiperidin-1-yl]-3-phenylpent-2-en-1-one.
| Compound Name | (Z)-5-(3-fluoro-4-methoxyphenyl)-1-[4-[4-(fluoromethyl)phenyl]-4-hydroxypiperidin-1-yl]-3-phenylpent-2-en-1-one |
|---|---|
| PubChem CID | 126494945 |
| Molecular Formula | C30H31F2NO3 |
| Molecular Weight | 491.58 g/mol |
| Exact Mass | 491.23 |
| IUPAC Name | (Z)-5-(3-fluoro-4-methoxyphenyl)-1-[4-[4-(fluoromethyl)phenyl]-4-hydroxypiperidin-1-yl]-3-phenylpent-2-en-1-one |
| SMILES | COc1ccc(CC/C(=C/C(=O)N2CCC(O)(c3ccc(CF)cc3)CC2)c2ccccc2)cc1F |
| InChI | InChI=1S/C30H31F2NO3/c1-36-28-14-10-22(19-27(28)32)7-11-25(24-5-3-2-4-6-24)20-29(34)33-17-15-30(35,16-18-33)26-12-8-23(21-31)9-13-26/h2-6,8-10,12-14,19-20,35H,7,11,15-18,21H2,1H3/b25-20- |
| InChIKey | IIGODVGDBFCTLT-QQTULTPQSA-N |
| XLogP | 5.83 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.58 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|