C25H31NO4 — CID 71747694
(E)-1-(4-hydroxy-4-phenylpiperidin-1-yl)-3-[3-methoxy-4-(2-methylpropoxy)phenyl]prop-2-en-1-one (PubChem CID 71747694) has the molecular formula C25H31NO4 and a molecular weight of 409.53 g/mol. Its IUPAC name is (E)-1-(4-hydroxy-4-phenylpiperidin-1-yl)-3-[3-methoxy-4-(2-methylpropoxy)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-hydroxy-4-phenylpiperidin-1-yl)-3-[3-methoxy-4-(2-methylpropoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 71747694 |
| Molecular Formula | C25H31NO4 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | (E)-1-(4-hydroxy-4-phenylpiperidin-1-yl)-3-[3-methoxy-4-(2-methylpropoxy)phenyl]prop-2-en-1-one |
| SMILES | COc1cc(/C=C/C(=O)N2CCC(O)(c3ccccc3)CC2)ccc1OCC(C)C |
| InChI | InChI=1S/C25H31NO4/c1-19(2)18-30-22-11-9-20(17-23(22)29-3)10-12-24(27)26-15-13-25(28,14-16-26)21-7-5-4-6-8-21/h4-12,17,19,28H,13-16,18H2,1-3H3/b12-10+ |
| InChIKey | GMLWOPCOSJGVCB-ZRDIBKRKSA-N |
| XLogP | 4.25 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|