C21H22BrNO3 — CID 44757959
3-(5-bromo-2-methoxyphenyl)-1-(4-hydroxy-4-phenylpiperidin-1-yl)prop-2-en-1-one (PubChem CID 44757959) has the molecular formula C21H22BrNO3 and a molecular weight of 416.32 g/mol. Its IUPAC name is 3-(5-bromo-2-methoxyphenyl)-1-(4-hydroxy-4-phenylpiperidin-1-yl)prop-2-en-1-one.
| Compound Name | 3-(5-bromo-2-methoxyphenyl)-1-(4-hydroxy-4-phenylpiperidin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 44757959 |
| Molecular Formula | C21H22BrNO3 |
| Molecular Weight | 416.32 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | 3-(5-bromo-2-methoxyphenyl)-1-(4-hydroxy-4-phenylpiperidin-1-yl)prop-2-en-1-one |
| SMILES | COc1ccc(Br)cc1C=CC(=O)N1CCC(O)(c2ccccc2)CC1 |
| InChI | InChI=1S/C21H22BrNO3/c1-26-19-9-8-18(22)15-16(19)7-10-20(24)23-13-11-21(25,12-14-23)17-5-3-2-4-6-17/h2-10,15,25H,11-14H2,1H3 |
| InChIKey | UKQLUIVLCNCGPZ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.32 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|