C17H18N4O3S — CID 126496328
(5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-(1,3-benzodioxol-5-ylmethylamino)methanol (PubChem CID 126496328) has the molecular formula C17H18N4O3S and a molecular weight of 358.42 g/mol. Its IUPAC name is (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-(1,3-benzodioxol-5-ylmethylamino)methanol.
| Compound Name | (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-(1,3-benzodioxol-5-ylmethylamino)methanol |
|---|---|
| PubChem CID | 126496328 |
| Molecular Formula | C17H18N4O3S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-(1,3-benzodioxol-5-ylmethylamino)methanol |
| SMILES | Cc1nnc2sc(C(O)NCc3ccc4c(c3)OCO4)c(N)c2c1C |
| InChI | InChI=1S/C17H18N4O3S/c1-8-9(2)20-21-17-13(8)14(18)15(25-17)16(22)19-6-10-3-4-11-12(5-10)24-7-23-11/h3-5,16,19,22H,6-7,18H2,1-2H3 |
| InChIKey | RPEVTQKBKHOGHI-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 102.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|