C16H19N5O2S — CID 126496368
(5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[(2-methoxy-4-pyridinyl)methylamino]methanol (PubChem CID 126496368) has the molecular formula C16H19N5O2S and a molecular weight of 345.43 g/mol. Its IUPAC name is (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[(2-methoxy-4-pyridinyl)methylamino]methanol.
| Compound Name | (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[(2-methoxy-4-pyridinyl)methylamino]methanol |
|---|---|
| PubChem CID | 126496368 |
| Molecular Formula | C16H19N5O2S |
| Molecular Weight | 345.43 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[(2-methoxy-4-pyridinyl)methylamino]methanol |
| SMILES | COc1cc(CNC(O)c2sc3nnc(C)c(C)c3c2N)ccn1 |
| InChI | InChI=1S/C16H19N5O2S/c1-8-9(2)20-21-16-12(8)13(17)14(24-16)15(22)19-7-10-4-5-18-11(6-10)23-3/h4-6,15,19,22H,7,17H2,1-3H3 |
| InChIKey | NJDNRGNKPORUQK-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 106.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.43 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|