C8H22N7O2PS — CID 126497354
1-[[[amino(butylamino)phosphinothioyl]amino]methyl]-3-[(carbamoylamino)methyl]urea (PubChem CID 126497354) has the molecular formula C8H22N7O2PS and a molecular weight of 311.35 g/mol. Its IUPAC name is 1-[[[amino(butylamino)phosphinothioyl]amino]methyl]-3-[(carbamoylamino)methyl]urea.
| Compound Name | 1-[[[amino(butylamino)phosphinothioyl]amino]methyl]-3-[(carbamoylamino)methyl]urea |
|---|---|
| PubChem CID | 126497354 |
| Molecular Formula | C8H22N7O2PS |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 1-[[[amino(butylamino)phosphinothioyl]amino]methyl]-3-[(carbamoylamino)methyl]urea |
| SMILES | CCCCNP(N)(=S)NCNC(=O)NCNC(N)=O |
| InChI | InChI=1S/C8H22N7O2PS/c1-2-3-4-14-18(10,19)15-6-13-8(17)12-5-11-7(9)16/h2-6H2,1H3,(H3,9,11,16)(H2,12,13,17)(H4,10,14,15,19) |
| InChIKey | UGKZAUHJCGCODF-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 146.33 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|