C17H15FN5O2P — CID 126499005
1-(3,4-dihydro-2H-quinoline-1-carbonyl)-4-(2-fluoro-6-phosphanylphenyl)tetrazol-5-one (PubChem CID 126499005) has the molecular formula C17H15FN5O2P and a molecular weight of 371.31 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-quinoline-1-carbonyl)-4-(2-fluoro-6-phosphanylphenyl)tetrazol-5-one.
| Compound Name | 1-(3,4-dihydro-2H-quinoline-1-carbonyl)-4-(2-fluoro-6-phosphanylphenyl)tetrazol-5-one |
|---|---|
| PubChem CID | 126499005 |
| Molecular Formula | C17H15FN5O2P |
| Molecular Weight | 371.31 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 1-(3,4-dihydro-2H-quinoline-1-carbonyl)-4-(2-fluoro-6-phosphanylphenyl)tetrazol-5-one |
| SMILES | O=C(N1CCCc2ccccc21)n1nnn(-c2c(F)cccc2P)c1=O |
| InChI | InChI=1S/C17H15FN5O2P/c18-12-7-3-9-14(26)15(12)22-17(25)23(20-19-22)16(24)21-10-4-6-11-5-1-2-8-13(11)21/h1-3,5,7-9H,4,6,10,26H2 |
| InChIKey | ZKSLZEUBNRGNJO-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 73.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.31 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'amidotetrazole', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|