C27H24N4O2 — CID 126499500
2-(6-methoxy-2-pyridinyl)-6-nona-3,7-diynyl-4-phenoxypyrrolo[2,1-f][1,2,4]triazine (PubChem CID 126499500) has the molecular formula C27H24N4O2 and a molecular weight of 436.52 g/mol. Its IUPAC name is 2-(6-methoxy-2-pyridinyl)-6-nona-3,7-diynyl-4-phenoxypyrrolo[2,1-f][1,2,4]triazine.
| Compound Name | 2-(6-methoxy-2-pyridinyl)-6-nona-3,7-diynyl-4-phenoxypyrrolo[2,1-f][1,2,4]triazine |
|---|---|
| PubChem CID | 126499500 |
| Molecular Formula | C27H24N4O2 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 2-(6-methoxy-2-pyridinyl)-6-nona-3,7-diynyl-4-phenoxypyrrolo[2,1-f][1,2,4]triazine |
| SMILES | CC#CCCC#CCCc1cc2c(Oc3ccccc3)nc(-c3cccc(OC)n3)nn2c1 |
| InChI | InChI=1S/C27H24N4O2/c1-3-4-5-6-7-8-10-14-21-19-24-27(33-22-15-11-9-12-16-22)29-26(30-31(24)20-21)23-17-13-18-25(28-23)32-2/h9,11-13,15-20H,5-6,10,14H2,1-2H3 |
| InChIKey | BZAQJWSMTXNPKC-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 61.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|