C21H20N4O5S — CID 126484205
2-[2-(6-methoxy-2-pyridinyl)-4-phenoxypyrrolo[2,1-f][1,2,4]triazin-5-yl]ethyl methanesulfonate (PubChem CID 126484205) has the molecular formula C21H20N4O5S and a molecular weight of 440.48 g/mol. Its IUPAC name is 2-[2-(6-methoxy-2-pyridinyl)-4-phenoxypyrrolo[2,1-f][1,2,4]triazin-5-yl]ethyl methanesulfonate.
| Compound Name | 2-[2-(6-methoxy-2-pyridinyl)-4-phenoxypyrrolo[2,1-f][1,2,4]triazin-5-yl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 126484205 |
| Molecular Formula | C21H20N4O5S |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | 2-[2-(6-methoxy-2-pyridinyl)-4-phenoxypyrrolo[2,1-f][1,2,4]triazin-5-yl]ethyl methanesulfonate |
| SMILES | COc1cccc(-c2nc(Oc3ccccc3)c3c(CCOS(C)(=O)=O)ccn3n2)n1 |
| InChI | InChI=1S/C21H20N4O5S/c1-28-18-10-6-9-17(22-18)20-23-21(30-16-7-4-3-5-8-16)19-15(11-13-25(19)24-20)12-14-29-31(2,26)27/h3-11,13H,12,14H2,1-2H3 |
| InChIKey | XETXHFZAMFXAPS-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 104.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|