C11H12N4O3S — CID 122453818
2-(6-phenyl-1,2,4,5-tetrazin-3-yl)ethyl methanesulfonate (PubChem CID 122453818) has the molecular formula C11H12N4O3S and a molecular weight of 280.31 g/mol. Its IUPAC name is 2-(6-phenyl-1,2,4,5-tetrazin-3-yl)ethyl methanesulfonate.
| Compound Name | 2-(6-phenyl-1,2,4,5-tetrazin-3-yl)ethyl methanesulfonate |
|---|---|
| PubChem CID | 122453818 |
| Molecular Formula | C11H12N4O3S |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 2-(6-phenyl-1,2,4,5-tetrazin-3-yl)ethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCc1nnc(-c2ccccc2)nn1 |
| InChI | InChI=1S/C11H12N4O3S/c1-19(16,17)18-8-7-10-12-14-11(15-13-10)9-5-3-2-4-6-9/h2-6H,7-8H2,1H3 |
| InChIKey | RKHMYOGLVQCWRR-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 94.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|