C22H27F6N5O2 — CID 126500510
cis-(1S,4R)-2,2-dimethyl-4-[[5-(trifluoromethyl)-2-[[2-(3,3,3-trifluoropropoxy)-3-pyridinyl]methylamino]pyrimidin-4-yl]amino]cyclohexan-1-ol (PubChem CID 126500510) has the molecular formula C22H27F6N5O2 and a molecular weight of 507.48 g/mol. Its IUPAC name is cis-(1S,4R)-2,2-dimethyl-4-[[5-(trifluoromethyl)-2-[[2-(3,3,3-trifluoropropoxy)-3-pyridinyl]methylamino]pyrimidin-4-yl]amino]cyclohexan-1-ol.
| Compound Name | cis-(1S,4R)-2,2-dimethyl-4-[[5-(trifluoromethyl)-2-[[2-(3,3,3-trifluoropropoxy)-3-pyridinyl]methylamino]pyrimidin-4-yl]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 126500510 |
| Molecular Formula | C22H27F6N5O2 |
| Molecular Weight | 507.48 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | cis-(1S,4R)-2,2-dimethyl-4-[[5-(trifluoromethyl)-2-[[2-(3,3,3-trifluoropropoxy)-3-pyridinyl]methylamino]pyrimidin-4-yl]amino]cyclohexan-1-ol |
| SMILES | CC1(C)C[C@H](Nc2nc(NCc3cccnc3OCCC(F)(F)F)ncc2C(F)(F)F)CC[C@@H]1O |
| InChI | InChI=1S/C22H27F6N5O2/c1-20(2)10-14(5-6-16(20)34)32-17-15(22(26,27)28)12-31-19(33-17)30-11-13-4-3-8-29-18(13)35-9-7-21(23,24)25/h3-4,8,12,14,16,34H,5-7,9-11H2,1-2H3,(H2,30,31,32,33)/t14-,16+/m1/s1 |
| InChIKey | OKULDLBSZRXBPI-ZBFHGGJFSA-N |
| XLogP | 5.19 |
| TPSA | 92.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.48 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |