C15H17NO — CID 126502678
4-(3,4-dimethylphenoxy)-2,3-dimethylpyridine (PubChem CID 126502678) has the molecular formula C15H17NO and a molecular weight of 227.31 g/mol. Its IUPAC name is 4-(3,4-dimethylphenoxy)-2,3-dimethylpyridine.
| Compound Name | 4-(3,4-dimethylphenoxy)-2,3-dimethylpyridine |
|---|---|
| PubChem CID | 126502678 |
| Molecular Formula | C15H17NO |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 4-(3,4-dimethylphenoxy)-2,3-dimethylpyridine |
| SMILES | Cc1ccc(Oc2ccnc(C)c2C)cc1C |
| InChI | InChI=1S/C15H17NO/c1-10-5-6-14(9-11(10)2)17-15-7-8-16-13(4)12(15)3/h5-9H,1-4H3 |
| InChIKey | IFBKEOLYDJRSHP-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |