C16H16N6O2 — CID 126504412
6-ethoxy-7-(3-ethylbenzimidazol-5-yl)-9H-purin-8-one (PubChem CID 126504412) has the molecular formula C16H16N6O2 and a molecular weight of 324.34 g/mol. Its IUPAC name is 6-ethoxy-7-(3-ethylbenzimidazol-5-yl)-9H-purin-8-one.
| Compound Name | 6-ethoxy-7-(3-ethylbenzimidazol-5-yl)-9H-purin-8-one |
|---|---|
| PubChem CID | 126504412 |
| Molecular Formula | C16H16N6O2 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 6-ethoxy-7-(3-ethylbenzimidazol-5-yl)-9H-purin-8-one |
| SMILES | CCOc1ncnc2[nH]c(=O)n(-c3ccc4ncn(CC)c4c3)c12 |
| InChI | InChI=1S/C16H16N6O2/c1-3-21-9-19-11-6-5-10(7-12(11)21)22-13-14(20-16(22)23)17-8-18-15(13)24-4-2/h5-9H,3-4H2,1-2H3,(H,17,18,20,23) |
| InChIKey | VGTOZUONMMGYFZ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 90.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |