C12H9ClN4O2 — CID 132588144
6-chloro-7-(4-methoxyphenyl)-9H-purin-8-one (PubChem CID 132588144) has the molecular formula C12H9ClN4O2 and a molecular weight of 276.68 g/mol. Its IUPAC name is 6-chloro-7-(4-methoxyphenyl)-9H-purin-8-one.
| Compound Name | 6-chloro-7-(4-methoxyphenyl)-9H-purin-8-one |
|---|---|
| PubChem CID | 132588144 |
| Molecular Formula | C12H9ClN4O2 |
| Molecular Weight | 276.68 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | 6-chloro-7-(4-methoxyphenyl)-9H-purin-8-one |
| SMILES | COc1ccc(-n2c(=O)[nH]c3ncnc(Cl)c32)cc1 |
| InChI | InChI=1S/C12H9ClN4O2/c1-19-8-4-2-7(3-5-8)17-9-10(13)14-6-15-11(9)16-12(17)18/h2-6H,1H3,(H,14,15,16,18) |
| InChIKey | QNAIGUZJROBQFQ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.68 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |