C15H8Cl2F6N4OS — CID 126507950
ethyl N-[5-cyano-5-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(trifluoromethylsulfanyl)pyrazol-3-yl]methanimidate (PubChem CID 126507950) has the molecular formula C15H8Cl2F6N4OS and a molecular weight of 477.22 g/mol. Its IUPAC name is ethyl N-[5-cyano-5-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(trifluoromethylsulfanyl)pyrazol-3-yl]methanimidate.
| Compound Name | ethyl N-[5-cyano-5-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(trifluoromethylsulfanyl)pyrazol-3-yl]methanimidate |
|---|---|
| PubChem CID | 126507950 |
| Molecular Formula | C15H8Cl2F6N4OS |
| Molecular Weight | 477.22 g/mol |
| Exact Mass | 475.97 |
| IUPAC Name | ethyl N-[5-cyano-5-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(trifluoromethylsulfanyl)pyrazol-3-yl]methanimidate |
| SMILES | CCOC=NC1=C(SC(F)(F)F)C(C#N)(c2c(Cl)cc(C(F)(F)F)cc2Cl)N=N1 |
| InChI | InChI=1S/C15H8Cl2F6N4OS/c1-2-28-6-25-12-11(29-15(21,22)23)13(5-24,27-26-12)10-8(16)3-7(4-9(10)17)14(18,19)20/h3-4,6H,2H2,1H3 |
| InChIKey | CEERVMYRPYQXOZ-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 70.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.22 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|