C13H7Cl2F3N2O2 — CID 174284703
[5-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-ethoxypyrazol-3-ylidene]methanone (PubChem CID 174284703) has the molecular formula C13H7Cl2F3N2O2 and a molecular weight of 351.11 g/mol. Its IUPAC name is [5-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-ethoxypyrazol-3-ylidene]methanone.
| Compound Name | [5-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-ethoxypyrazol-3-ylidene]methanone |
|---|---|
| PubChem CID | 174284703 |
| Molecular Formula | C13H7Cl2F3N2O2 |
| Molecular Weight | 351.11 g/mol |
| Exact Mass | 349.98 |
| IUPAC Name | [5-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-ethoxypyrazol-3-ylidene]methanone |
| SMILES | CCOC1=C(c2c(Cl)cc(C(F)(F)F)cc2Cl)N=NC1=C=O |
| InChI | InChI=1S/C13H7Cl2F3N2O2/c1-2-22-12-9(5-21)19-20-11(12)10-7(14)3-6(4-8(10)15)13(16,17)18/h3-4H,2H2,1H3 |
| InChIKey | PYHXWMWIJCAXIU-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.11 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|