C20H24O4 — CID 126508977
(6S,7aR)-7a-[(2R)-1-(4-methoxyphenyl)propan-2-yl]-6-prop-2-enyl-6,7-dihydro-1,3-benzodioxol-5-one (PubChem CID 126508977) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is (6S,7aR)-7a-[(2R)-1-(4-methoxyphenyl)propan-2-yl]-6-prop-2-enyl-6,7-dihydro-1,3-benzodioxol-5-one.
| Compound Name | (6S,7aR)-7a-[(2R)-1-(4-methoxyphenyl)propan-2-yl]-6-prop-2-enyl-6,7-dihydro-1,3-benzodioxol-5-one |
|---|---|
| PubChem CID | 126508977 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | (6S,7aR)-7a-[(2R)-1-(4-methoxyphenyl)propan-2-yl]-6-prop-2-enyl-6,7-dihydro-1,3-benzodioxol-5-one |
| SMILES | C=CC[C@H]1C[C@]2([C@H](C)Cc3ccc(OC)cc3)OCOC2=CC1=O |
| InChI | InChI=1S/C20H24O4/c1-4-5-16-12-20(19(11-18(16)21)23-13-24-20)14(2)10-15-6-8-17(22-3)9-7-15/h4,6-9,11,14,16H,1,5,10,12-13H2,2-3H3/t14-,16+,20-/m1/s1 |
| InChIKey | SJURKDMRNWZHKL-PTSWNOGYSA-N |
| XLogP | 3.67 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|