C22H28O5 — CID 126509412
(6S,7aR)-7a-[1-(3,4-dimethoxyphenyl)butan-2-yl]-6-prop-2-enyl-6,7-dihydro-1,3-benzodioxol-5-one (PubChem CID 126509412) has the molecular formula C22H28O5 and a molecular weight of 372.46 g/mol. Its IUPAC name is (6S,7aR)-7a-[1-(3,4-dimethoxyphenyl)butan-2-yl]-6-prop-2-enyl-6,7-dihydro-1,3-benzodioxol-5-one.
| Compound Name | (6S,7aR)-7a-[1-(3,4-dimethoxyphenyl)butan-2-yl]-6-prop-2-enyl-6,7-dihydro-1,3-benzodioxol-5-one |
|---|---|
| PubChem CID | 126509412 |
| Molecular Formula | C22H28O5 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | (6S,7aR)-7a-[1-(3,4-dimethoxyphenyl)butan-2-yl]-6-prop-2-enyl-6,7-dihydro-1,3-benzodioxol-5-one |
| SMILES | C=CC[C@H]1C[C@]2(C(CC)Cc3ccc(OC)c(OC)c3)OCOC2=CC1=O |
| InChI | InChI=1S/C22H28O5/c1-5-7-16-13-22(21(12-18(16)23)26-14-27-22)17(6-2)10-15-8-9-19(24-3)20(11-15)25-4/h5,8-9,11-12,16-17H,1,6-7,10,13-14H2,2-4H3/t16-,17?,22+/m0/s1 |
| InChIKey | IHGQKLLXENXXED-LWCIBLMUSA-N |
| XLogP | 4.06 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|