C22H28O4 — CID 126682628
(6R,7aS)-7a-[1-(3,4-dimethoxyphenyl)propan-2-yl]-6-prop-2-enyl-2,3,6,7-tetrahydro-1-benzofuran-5-one (PubChem CID 126682628) has the molecular formula C22H28O4 and a molecular weight of 356.46 g/mol. Its IUPAC name is (6R,7aS)-7a-[1-(3,4-dimethoxyphenyl)propan-2-yl]-6-prop-2-enyl-2,3,6,7-tetrahydro-1-benzofuran-5-one.
| Compound Name | (6R,7aS)-7a-[1-(3,4-dimethoxyphenyl)propan-2-yl]-6-prop-2-enyl-2,3,6,7-tetrahydro-1-benzofuran-5-one |
|---|---|
| PubChem CID | 126682628 |
| Molecular Formula | C22H28O4 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | (6R,7aS)-7a-[1-(3,4-dimethoxyphenyl)propan-2-yl]-6-prop-2-enyl-2,3,6,7-tetrahydro-1-benzofuran-5-one |
| SMILES | C=CC[C@@H]1C[C@@]2(C(C)Cc3ccc(OC)c(OC)c3)OCCC2=CC1=O |
| InChI | InChI=1S/C22H28O4/c1-5-6-17-14-22(18(9-10-26-22)13-19(17)23)15(2)11-16-7-8-20(24-3)21(12-16)25-4/h5,7-8,12-13,15,17H,1,6,9-11,14H2,2-4H3/t15?,17-,22+/m1/s1 |
| InChIKey | ADWSJNUETZGUNT-NXZOTENYSA-N |
| XLogP | 4.13 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|