C20H23Cl2FN4S — CID 1265097
1-[2-[4-(2,5-dichlorophenyl)piperazin-1-yl]ethyl]-3-(4-fluoro-3-methylphenyl)thiourea (PubChem CID 1265097) has the molecular formula C20H23Cl2FN4S and a molecular weight of 441.40 g/mol. Its IUPAC name is 1-[2-[4-(2,5-dichlorophenyl)piperazin-1-yl]ethyl]-3-(4-fluoro-3-methylphenyl)thiourea.
| Compound Name | 1-[2-[4-(2,5-dichlorophenyl)piperazin-1-yl]ethyl]-3-(4-fluoro-3-methylphenyl)thiourea |
|---|---|
| PubChem CID | 1265097 |
| Molecular Formula | C20H23Cl2FN4S |
| Molecular Weight | 441.40 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | 1-[2-[4-(2,5-dichlorophenyl)piperazin-1-yl]ethyl]-3-(4-fluoro-3-methylphenyl)thiourea |
| SMILES | Cc1cc(NC(=S)NCCN2CCN(c3cc(Cl)ccc3Cl)CC2)ccc1F |
| InChI | InChI=1S/C20H23Cl2FN4S/c1-14-12-16(3-5-18(14)23)25-20(28)24-6-7-26-8-10-27(11-9-26)19-13-15(21)2-4-17(19)22/h2-5,12-13H,6-11H2,1H3,(H2,24,25,28) |
| InChIKey | IWDNVEXDSLBGRT-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.40 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|