C22H27ClN6O2S — CID 126513506
2-[1-[(6-amino-5-chloropyrimidin-4-yl)methoxymethylamino]ethyl]-N-(3-tert-butylphenyl)-1,3-thiazole-5-carboxamide (PubChem CID 126513506) has the molecular formula C22H27ClN6O2S and a molecular weight of 475.02 g/mol. Its IUPAC name is 2-[1-[(6-amino-5-chloropyrimidin-4-yl)methoxymethylamino]ethyl]-N-(3-tert-butylphenyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[1-[(6-amino-5-chloropyrimidin-4-yl)methoxymethylamino]ethyl]-N-(3-tert-butylphenyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 126513506 |
| Molecular Formula | C22H27ClN6O2S |
| Molecular Weight | 475.02 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | 2-[1-[(6-amino-5-chloropyrimidin-4-yl)methoxymethylamino]ethyl]-N-(3-tert-butylphenyl)-1,3-thiazole-5-carboxamide |
| SMILES | CC(NCOCc1ncnc(N)c1Cl)c1ncc(C(=O)Nc2cccc(C(C)(C)C)c2)s1 |
| InChI | InChI=1S/C22H27ClN6O2S/c1-13(28-12-31-10-16-18(23)19(24)27-11-26-16)21-25-9-17(32-21)20(30)29-15-7-5-6-14(8-15)22(2,3)4/h5-9,11,13,28H,10,12H2,1-4H3,(H,29,30)(H2,24,26,27) |
| InChIKey | XPFCYEWZGWQNAZ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 115.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.02 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|