C23H28BrN5O3S — CID 91388143
benzyl N-[1-[5-[(6-tert-butylpyrimidin-4-yl)carbamoyl]-1,3-thiazol-2-yl]ethyl]carbamate;bromomethane (PubChem CID 91388143) has the molecular formula C23H28BrN5O3S and a molecular weight of 534.48 g/mol. Its IUPAC name is benzyl N-[1-[5-[(6-tert-butylpyrimidin-4-yl)carbamoyl]-1,3-thiazol-2-yl]ethyl]carbamate;bromomethane.
| Compound Name | benzyl N-[1-[5-[(6-tert-butylpyrimidin-4-yl)carbamoyl]-1,3-thiazol-2-yl]ethyl]carbamate;bromomethane |
|---|---|
| PubChem CID | 91388143 |
| Molecular Formula | C23H28BrN5O3S |
| Molecular Weight | 534.48 g/mol |
| Exact Mass | 533.11 |
| IUPAC Name | benzyl N-[1-[5-[(6-tert-butylpyrimidin-4-yl)carbamoyl]-1,3-thiazol-2-yl]ethyl]carbamate;bromomethane |
| SMILES | CBr.CC(NC(=O)OCc1ccccc1)c1ncc(C(=O)Nc2cc(C(C)(C)C)ncn2)s1 |
| InChI | InChI=1S/C22H25N5O3S.CH3Br/c1-14(26-21(29)30-12-15-8-6-5-7-9-15)20-23-11-16(31-20)19(28)27-18-10-17(22(2,3)4)24-13-25-18;1-2/h5-11,13-14H,12H2,1-4H3,(H,26,29)(H,24,25,27,28);1H3 |
| InChIKey | CMKSOXFELHIDFF-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 106.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.48 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|