C15H19N5 — CID 126514980
5-[[[(E)-2-(5-ethenyl-1H-pyrazol-4-yl)ethenyl]amino]methyl]-4-methylbenzene-1,3-diamine (PubChem CID 126514980) has the molecular formula C15H19N5 and a molecular weight of 269.35 g/mol. Its IUPAC name is 5-[[[(E)-2-(5-ethenyl-1H-pyrazol-4-yl)ethenyl]amino]methyl]-4-methylbenzene-1,3-diamine.
| Compound Name | 5-[[[(E)-2-(5-ethenyl-1H-pyrazol-4-yl)ethenyl]amino]methyl]-4-methylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 126514980 |
| Molecular Formula | C15H19N5 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 5-[[[(E)-2-(5-ethenyl-1H-pyrazol-4-yl)ethenyl]amino]methyl]-4-methylbenzene-1,3-diamine |
| SMILES | C=Cc1[nH]ncc1/C=C/NCc1cc(N)cc(N)c1C |
| InChI | InChI=1S/C15H19N5/c1-3-15-11(9-19-20-15)4-5-18-8-12-6-13(16)7-14(17)10(12)2/h3-7,9,18H,1,8,16-17H2,2H3,(H,19,20)/b5-4+ |
| InChIKey | FBCXGQKQQRLFMP-SNAWJCMRSA-N |
| XLogP | 2.29 |
| TPSA | 92.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|