About 4-ethenyl-N'-(methylamino)-1H-pyrazole-5-carboximidamide
4-ethenyl-N'-(methylamino)-1H-pyrazole-5-carboximidamide (PubChem CID 166739034) has the molecular formula C7H11N5
and a molecular weight of 165.20 g/mol. Its IUPAC name is 4-ethenyl-N'-(methylamino)-1H-pyrazole-5-carboximidamide.
Molecular Properties
| Compound Name | 4-ethenyl-N'-(methylamino)-1H-pyrazole-5-carboximidamide |
| PubChem CID | 166739034 |
| Molecular Formula | C7H11N5 |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.10 |
| IUPAC Name | 4-ethenyl-N'-(methylamino)-1H-pyrazole-5-carboximidamide |
| SMILES | C=Cc1cn[nH]c1/C(N)=N\NC |
| InChI | InChI=1S/C7H11N5/c1-3-5-4-10-11-6(5)7(8)12-9-2/h3-4,9H,1H2,2H3,(H2,8,12)(H,10,11) |
| InChIKey | SKPNCZIQTHPHMH-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 79.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-ethenyl-N'-(methylamino)-1H-pyrazole-5-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenyl-N'-(methylamino)-1H-pyrazole-5-carboximidamide?
The IUPAC name of 4-ethenyl-N'-(methylamino)-1H-pyrazole-5-carboximidamide (CID 166739034) is 4-ethenyl-N'-(methylamino)-1H-pyrazole-5-carboximidamide.
What is the SMILES notation for 4-ethenyl-N'-(methylamino)-1H-pyrazole-5-carboximidamide?
The canonical SMILES for 4-ethenyl-N'-(methylamino)-1H-pyrazole-5-carboximidamide is C=Cc1cn[nH]c1/C(N)=N\NC.
What is the InChIKey of 4-ethenyl-N'-(methylamino)-1H-pyrazole-5-carboximidamide?
The InChIKey is SKPNCZIQTHPHMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N5/c1-3-5-4-10-11-6(5)7(8)12-9-2/h3-4,9H,1H2,2H3,(H2,8,12)(H,10,11).
What are the key properties of 4-ethenyl-N'-(methylamino)-1H-pyrazole-5-carboximidamide?
4-ethenyl-N'-(methylamino)-1H-pyrazole-5-carboximidamide has a molecular weight of 165.20 g/mol, XLogP of -0.11, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenyl-N'-(methylamino)-1H-pyrazole-5-carboximidamide is sourced from PubChem (CID 166739034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).