C8H10N2 — CID 123564030
5-buta-1,3-dien-2-yl-4-methyl-1H-pyrazole (PubChem CID 123564030) has the molecular formula C8H10N2 and a molecular weight of 134.18 g/mol. Its IUPAC name is 5-buta-1,3-dien-2-yl-4-methyl-1H-pyrazole.
| Compound Name | 5-buta-1,3-dien-2-yl-4-methyl-1H-pyrazole |
|---|---|
| PubChem CID | 123564030 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | 5-buta-1,3-dien-2-yl-4-methyl-1H-pyrazole |
| SMILES | C=CC(=C)c1[nH]ncc1C |
| InChI | InChI=1S/C8H10N2/c1-4-6(2)8-7(3)5-9-10-8/h4-5H,1-2H2,3H3,(H,9,10) |
| InChIKey | KFEASFQWDLNIRW-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|