C8H12N2 — CID 138671207
4-ethyl-5-prop-1-en-2-yl-1H-pyrazole (PubChem CID 138671207) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is 4-ethyl-5-prop-1-en-2-yl-1H-pyrazole.
| Compound Name | 4-ethyl-5-prop-1-en-2-yl-1H-pyrazole |
|---|---|
| PubChem CID | 138671207 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | 4-ethyl-5-prop-1-en-2-yl-1H-pyrazole |
| SMILES | C=C(C)c1[nH]ncc1CC |
| InChI | InChI=1S/C8H12N2/c1-4-7-5-9-10-8(7)6(2)3/h5H,2,4H2,1,3H3,(H,9,10) |
| InChIKey | YPJQFUKQDIQNCA-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |