C6H9N3O3S — CID 175853989
4-(methylsulfonylmethyl)-1H-pyrazole-5-carboxamide (PubChem CID 175853989) has the molecular formula C6H9N3O3S and a molecular weight of 203.22 g/mol. Its IUPAC name is 4-(methylsulfonylmethyl)-1H-pyrazole-5-carboxamide.
| Compound Name | 4-(methylsulfonylmethyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 175853989 |
| Molecular Formula | C6H9N3O3S |
| Molecular Weight | 203.22 g/mol |
| Exact Mass | 203.04 |
| IUPAC Name | 4-(methylsulfonylmethyl)-1H-pyrazole-5-carboxamide |
| SMILES | CS(=O)(=O)Cc1cn[nH]c1C(N)=O |
| InChI | InChI=1S/C6H9N3O3S/c1-13(11,12)3-4-2-8-9-5(4)6(7)10/h2H,3H2,1H3,(H2,7,10)(H,8,9) |
| InChIKey | WRKZQUXDWSWNQB-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 105.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.22 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |