C9H17N5O3S — CID 63863361
4-amino-N-[2-(methanesulfonamido)-2-methylpropyl]-1H-pyrazole-5-carboxamide (PubChem CID 63863361) has the molecular formula C9H17N5O3S and a molecular weight of 275.33 g/mol. Its IUPAC name is 4-amino-N-[2-(methanesulfonamido)-2-methylpropyl]-1H-pyrazole-5-carboxamide.
| Compound Name | 4-amino-N-[2-(methanesulfonamido)-2-methylpropyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 63863361 |
| Molecular Formula | C9H17N5O3S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 4-amino-N-[2-(methanesulfonamido)-2-methylpropyl]-1H-pyrazole-5-carboxamide |
| SMILES | CC(C)(CNC(=O)c1[nH]ncc1N)NS(C)(=O)=O |
| InChI | InChI=1S/C9H17N5O3S/c1-9(2,14-18(3,16)17)5-11-8(15)7-6(10)4-12-13-7/h4,14H,5,10H2,1-3H3,(H,11,15)(H,12,13) |
| InChIKey | NQULKJKNGQHARM-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 129.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |