C10H19N5O3S — CID 63103781
4-amino-N-[3-[ethyl(methylsulfonyl)amino]propyl]-1H-pyrazole-5-carboxamide (PubChem CID 63103781) has the molecular formula C10H19N5O3S and a molecular weight of 289.36 g/mol. Its IUPAC name is 4-amino-N-[3-[ethyl(methylsulfonyl)amino]propyl]-1H-pyrazole-5-carboxamide.
| Compound Name | 4-amino-N-[3-[ethyl(methylsulfonyl)amino]propyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 63103781 |
| Molecular Formula | C10H19N5O3S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 4-amino-N-[3-[ethyl(methylsulfonyl)amino]propyl]-1H-pyrazole-5-carboxamide |
| SMILES | CCN(CCCNC(=O)c1[nH]ncc1N)S(C)(=O)=O |
| InChI | InChI=1S/C10H19N5O3S/c1-3-15(19(2,17)18)6-4-5-12-10(16)9-8(11)7-13-14-9/h7H,3-6,11H2,1-2H3,(H,12,16)(H,13,14) |
| InChIKey | NLNYMMJACIDFOW-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 121.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|